C14H19F3N2O3S — CID 21119210
4-[2,3-dimethyl-6-(trifluoromethyl)-2,3-dihydrobenzimidazol-3-ium-1-yl]butane-1-sulfonate (PubChem CID 21119210) has the molecular formula C14H19F3N2O3S and a molecular weight of 352.38 g/mol. Its IUPAC name is 4-[2,3-dimethyl-6-(trifluoromethyl)-2,3-dihydrobenzimidazol-3-ium-1-yl]butane-1-sulfonate.
| Compound Name | 4-[2,3-dimethyl-6-(trifluoromethyl)-2,3-dihydrobenzimidazol-3-ium-1-yl]butane-1-sulfonate |
|---|---|
| PubChem CID | 21119210 |
| Molecular Formula | C14H19F3N2O3S |
| Molecular Weight | 352.38 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | 4-[2,3-dimethyl-6-(trifluoromethyl)-2,3-dihydrobenzimidazol-3-ium-1-yl]butane-1-sulfonate |
| SMILES | CC1N(CCCCS(=O)(=O)[O-])c2cc(C(F)(F)F)ccc2[NH+]1C |
| InChI | InChI=1S/C14H19F3N2O3S/c1-10-18(2)12-6-5-11(14(15,16)17)9-13(12)19(10)7-3-4-8-23(20,21)22/h5-6,9-10H,3-4,7-8H2,1-2H3,(H,20,21,22) |
| InChIKey | NMONNJBGHNHXSU-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 64.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.38 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|