C14H22N2O3 — CID 21119387
3-butyl-1,4-dimethyl-7,9-diazaspiro[4.5]decane-6,8,10-trione (PubChem CID 21119387) has the molecular formula C14H22N2O3 and a molecular weight of 266.34 g/mol. Its IUPAC name is 3-butyl-1,4-dimethyl-7,9-diazaspiro[4.5]decane-6,8,10-trione.
| Compound Name | 3-butyl-1,4-dimethyl-7,9-diazaspiro[4.5]decane-6,8,10-trione |
|---|---|
| PubChem CID | 21119387 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | 3-butyl-1,4-dimethyl-7,9-diazaspiro[4.5]decane-6,8,10-trione |
| SMILES | CCCCC1CC(C)C2(C(=O)NC(=O)NC2=O)C1C |
| InChI | InChI=1S/C14H22N2O3/c1-4-5-6-10-7-8(2)14(9(10)3)11(17)15-13(19)16-12(14)18/h8-10H,4-7H2,1-3H3,(H2,15,16,17,18,19) |
| InChIKey | HAPFQQZPVLKXBF-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|