About CID 21119633
CID 21119633 (PubChem CID 21119633) has the molecular formula C9H18ClSi
and a molecular weight of 189.78 g/mol.
Molecular Properties
| Compound Name | CID 21119633 |
| PubChem CID | 21119633 |
| Molecular Formula | C9H18ClSi |
| Molecular Weight | 189.78 g/mol |
| Exact Mass | 189.09 |
| IUPAC Name | — |
| SMILES | CC(C)(C)C([Si])(Cl)C(C)(C)C |
| InChI | InChI=1S/C9H18ClSi/c1-7(2,3)9(10,11)8(4,5)6/h1-6H3 |
| InChIKey | BQWXLMJHXSXRBQ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.78 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 21119633 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 21119633?
The IUPAC name of CID 21119633 (CID 21119633) is not available.
What is the SMILES notation for CID 21119633?
The canonical SMILES for CID 21119633 is CC(C)(C)C([Si])(Cl)C(C)(C)C.
What is the InChIKey of CID 21119633?
The InChIKey is BQWXLMJHXSXRBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18ClSi/c1-7(2,3)9(10,11)8(4,5)6/h1-6H3.
What are the key properties of CID 21119633?
CID 21119633 has a molecular weight of 189.78 g/mol, XLogP of 3.18, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 21119633 is sourced from PubChem (CID 21119633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).