About 6-O-decyl 1-O-octyl 2,2,3-trimethylhexanedioate
6-O-decyl 1-O-octyl 2,2,3-trimethylhexanedioate (PubChem CID 21119657) has the molecular formula C27H52O4
and a molecular weight of 440.71 g/mol. Its IUPAC name is 6-O-decyl 1-O-octyl 2,2,3-trimethylhexanedioate.
Molecular Properties
| Compound Name | 6-O-decyl 1-O-octyl 2,2,3-trimethylhexanedioate |
| PubChem CID | 21119657 |
| Molecular Formula | C27H52O4 |
| Molecular Weight | 440.71 g/mol |
| Exact Mass | 440.39 |
| IUPAC Name | 6-O-decyl 1-O-octyl 2,2,3-trimethylhexanedioate |
| SMILES | CCCCCCCCCCOC(=O)CCC(C)C(C)(C)C(=O)OCCCCCCCC |
| InChI | InChI=1S/C27H52O4/c1-6-8-10-12-14-15-17-18-22-30-25(28)21-20-24(3)27(4,5)26(29)31-23-19-16-13-11-9-7-2/h24H,6-23H2,1-5H3 |
| InChIKey | UQXSJLGPENAYHA-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 440.71 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-O-decyl 1-O-octyl 2,2,3-trimethylhexanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-O-decyl 1-O-octyl 2,2,3-trimethylhexanedioate?
The IUPAC name of 6-O-decyl 1-O-octyl 2,2,3-trimethylhexanedioate (CID 21119657) is 6-O-decyl 1-O-octyl 2,2,3-trimethylhexanedioate.
What is the SMILES notation for 6-O-decyl 1-O-octyl 2,2,3-trimethylhexanedioate?
The canonical SMILES for 6-O-decyl 1-O-octyl 2,2,3-trimethylhexanedioate is CCCCCCCCCCOC(=O)CCC(C)C(C)(C)C(=O)OCCCCCCCC.
What is the InChIKey of 6-O-decyl 1-O-octyl 2,2,3-trimethylhexanedioate?
The InChIKey is UQXSJLGPENAYHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H52O4/c1-6-8-10-12-14-15-17-18-22-30-25(28)21-20-24(3)27(4,5)26(29)31-23-19-16-13-11-9-7-2/h24H,6-23H2,1-5H3.
What are the key properties of 6-O-decyl 1-O-octyl 2,2,3-trimethylhexanedioate?
6-O-decyl 1-O-octyl 2,2,3-trimethylhexanedioate has a molecular weight of 440.71 g/mol, XLogP of 8.02, 21 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-O-decyl 1-O-octyl 2,2,3-trimethylhexanedioate is sourced from PubChem (CID 21119657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).