About ethyl sulfate;pentan-3-yl(2-phenothiazin-10-ylpropyl)azanium
ethyl sulfate;pentan-3-yl(2-phenothiazin-10-ylpropyl)azanium (PubChem CID 21119980) has the molecular formula C22H32N2O4S2
and a molecular weight of 452.64 g/mol. Its IUPAC name is ethyl sulfate;pentan-3-yl(2-phenothiazin-10-ylpropyl)azanium.
Molecular Properties
| Compound Name | ethyl sulfate;pentan-3-yl(2-phenothiazin-10-ylpropyl)azanium |
| PubChem CID | 21119980 |
| Molecular Formula | C22H32N2O4S2 |
| Molecular Weight | 452.64 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | ethyl sulfate;pentan-3-yl(2-phenothiazin-10-ylpropyl)azanium |
| SMILES | CCC(CC)[NH2+]CC(C)N1c2ccccc2Sc2ccccc21.CCOS(=O)(=O)[O-] |
| InChI | InChI=1S/C20H26N2S.C2H6O4S/c1-4-16(5-2)21-14-15(3)22-17-10-6-8-12-19(17)23-20-13-9-7-11-18(20)22;1-2-6-7(3,4)5/h6-13,15-16,21H,4-5,14H2,1-3H3;2H2,1H3,(H,3,4,5) |
| InChIKey | AUTSBJSNOBISJI-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 86.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 452.64 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze ethyl sulfate;pentan-3-yl(2-phenothiazin-10-ylpropyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl sulfate;pentan-3-yl(2-phenothiazin-10-ylpropyl)azanium?
The IUPAC name of ethyl sulfate;pentan-3-yl(2-phenothiazin-10-ylpropyl)azanium (CID 21119980) is ethyl sulfate;pentan-3-yl(2-phenothiazin-10-ylpropyl)azanium.
What is the SMILES notation for ethyl sulfate;pentan-3-yl(2-phenothiazin-10-ylpropyl)azanium?
The canonical SMILES for ethyl sulfate;pentan-3-yl(2-phenothiazin-10-ylpropyl)azanium is CCC(CC)[NH2+]CC(C)N1c2ccccc2Sc2ccccc21.CCOS(=O)(=O)[O-].
What is the InChIKey of ethyl sulfate;pentan-3-yl(2-phenothiazin-10-ylpropyl)azanium?
The InChIKey is AUTSBJSNOBISJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26N2S.C2H6O4S/c1-4-16(5-2)21-14-15(3)22-17-10-6-8-12-19(17)23-20-13-9-7-11-18(20)22;1-2-6-7(3,4)5/h6-13,15-16,21H,4-5,14H2,1-3H3;2H2,1H3,(H,3,4,5).
What are the key properties of ethyl sulfate;pentan-3-yl(2-phenothiazin-10-ylpropyl)azanium?
ethyl sulfate;pentan-3-yl(2-phenothiazin-10-ylpropyl)azanium has a molecular weight of 452.64 g/mol, XLogP of 3.91, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl sulfate;pentan-3-yl(2-phenothiazin-10-ylpropyl)azanium is sourced from PubChem (CID 21119980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).