About 2-[1-(1-ethoxyethyl)benzimidazol-2-yl]sulfanyl-N,N-dimethylethanamine
2-[1-(1-ethoxyethyl)benzimidazol-2-yl]sulfanyl-N,N-dimethylethanamine (PubChem CID 21120353) has the molecular formula C15H23N3OS
and a molecular weight of 293.44 g/mol. Its IUPAC name is 2-[1-(1-ethoxyethyl)benzimidazol-2-yl]sulfanyl-N,N-dimethylethanamine.
Molecular Properties
| Compound Name | 2-[1-(1-ethoxyethyl)benzimidazol-2-yl]sulfanyl-N,N-dimethylethanamine |
| PubChem CID | 21120353 |
| Molecular Formula | C15H23N3OS |
| Molecular Weight | 293.44 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | 2-[1-(1-ethoxyethyl)benzimidazol-2-yl]sulfanyl-N,N-dimethylethanamine |
| SMILES | CCOC(C)n1c(SCCN(C)C)nc2ccccc21 |
| InChI | InChI=1S/C15H23N3OS/c1-5-19-12(2)18-14-9-7-6-8-13(14)16-15(18)20-11-10-17(3)4/h6-9,12H,5,10-11H2,1-4H3 |
| InChIKey | JTGGLLNHVGRWOQ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.44 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[1-(1-ethoxyethyl)benzimidazol-2-yl]sulfanyl-N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(1-ethoxyethyl)benzimidazol-2-yl]sulfanyl-N,N-dimethylethanamine?
The IUPAC name of 2-[1-(1-ethoxyethyl)benzimidazol-2-yl]sulfanyl-N,N-dimethylethanamine (CID 21120353) is 2-[1-(1-ethoxyethyl)benzimidazol-2-yl]sulfanyl-N,N-dimethylethanamine.
What is the SMILES notation for 2-[1-(1-ethoxyethyl)benzimidazol-2-yl]sulfanyl-N,N-dimethylethanamine?
The canonical SMILES for 2-[1-(1-ethoxyethyl)benzimidazol-2-yl]sulfanyl-N,N-dimethylethanamine is CCOC(C)n1c(SCCN(C)C)nc2ccccc21.
What is the InChIKey of 2-[1-(1-ethoxyethyl)benzimidazol-2-yl]sulfanyl-N,N-dimethylethanamine?
The InChIKey is JTGGLLNHVGRWOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23N3OS/c1-5-19-12(2)18-14-9-7-6-8-13(14)16-15(18)20-11-10-17(3)4/h6-9,12H,5,10-11H2,1-4H3.
What are the key properties of 2-[1-(1-ethoxyethyl)benzimidazol-2-yl]sulfanyl-N,N-dimethylethanamine?
2-[1-(1-ethoxyethyl)benzimidazol-2-yl]sulfanyl-N,N-dimethylethanamine has a molecular weight of 293.44 g/mol, XLogP of 3.24, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(1-ethoxyethyl)benzimidazol-2-yl]sulfanyl-N,N-dimethylethanamine is sourced from PubChem (CID 21120353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).