C16H15NO5 — CID 2112038
1,3-benzodioxol-5-yl 4-acetyl-3,5-dimethyl-1H-pyrrole-2-carboxylate (PubChem CID 2112038) has the molecular formula C16H15NO5 and a molecular weight of 301.30 g/mol. Its IUPAC name is 1,3-benzodioxol-5-yl 4-acetyl-3,5-dimethyl-1H-pyrrole-2-carboxylate.
| Compound Name | 1,3-benzodioxol-5-yl 4-acetyl-3,5-dimethyl-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 2112038 |
| Molecular Formula | C16H15NO5 |
| Molecular Weight | 301.30 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 1,3-benzodioxol-5-yl 4-acetyl-3,5-dimethyl-1H-pyrrole-2-carboxylate |
| SMILES | CC(=O)c1c(C)[nH]c(C(=O)Oc2ccc3c(c2)OCO3)c1C |
| InChI | InChI=1S/C16H15NO5/c1-8-14(10(3)18)9(2)17-15(8)16(19)22-11-4-5-12-13(6-11)21-7-20-12/h4-6,17H,7H2,1-3H3 |
| InChIKey | NLAMLGXHGUOXJY-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 77.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.30 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|