About pyrene-1-carboxamide
pyrene-1-carboxamide (PubChem CID 21120429) has the molecular formula C17H11NO
and a molecular weight of 245.28 g/mol. Its IUPAC name is pyrene-1-carboxamide.
Molecular Properties
| Compound Name | pyrene-1-carboxamide |
| PubChem CID | 21120429 |
| Molecular Formula | C17H11NO |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | pyrene-1-carboxamide |
| SMILES | NC(=O)c1ccc2ccc3cccc4ccc1c2c34 |
| InChI | InChI=1S/C17H11NO/c18-17(19)14-9-7-12-5-4-10-2-1-3-11-6-8-13(14)16(12)15(10)11/h1-9H,(H2,18,19) |
| InChIKey | JQWVVTBOEPIYHI-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze pyrene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrene-1-carboxamide?
The IUPAC name of pyrene-1-carboxamide (CID 21120429) is pyrene-1-carboxamide.
What is the SMILES notation for pyrene-1-carboxamide?
The canonical SMILES for pyrene-1-carboxamide is NC(=O)c1ccc2ccc3cccc4ccc1c2c34.
What is the InChIKey of pyrene-1-carboxamide?
The InChIKey is JQWVVTBOEPIYHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11NO/c18-17(19)14-9-7-12-5-4-10-2-1-3-11-6-8-13(14)16(12)15(10)11/h1-9H,(H2,18,19).
What are the key properties of pyrene-1-carboxamide?
pyrene-1-carboxamide has a molecular weight of 245.28 g/mol, XLogP of 3.68, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for pyrene-1-carboxamide is sourced from PubChem (CID 21120429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).