C14H20N4O8S — CID 21120679
(2S)-2-amino-5-[[(2R)-1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid;pyrrole-2,5-dione (PubChem CID 21120679) has the molecular formula C14H20N4O8S and a molecular weight of 404.40 g/mol. Its IUPAC name is (2S)-2-amino-5-[[(2R)-1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid;pyrrole-2,5-dione.
| Compound Name | (2S)-2-amino-5-[[(2R)-1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid;pyrrole-2,5-dione |
|---|---|
| PubChem CID | 21120679 |
| Molecular Formula | C14H20N4O8S |
| Molecular Weight | 404.40 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | (2S)-2-amino-5-[[(2R)-1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid;pyrrole-2,5-dione |
| SMILES | N[C@@H](CCC(=O)N[C@@H](CS)C(=O)NCC(=O)O)C(=O)O.O=C1C=CC(=O)N1 |
| InChI | InChI=1S/C10H17N3O6S.C4H3NO2/c11-5(10(18)19)1-2-7(14)13-6(4-20)9(17)12-3-8(15)16;6-3-1-2-4(7)5-3/h5-6,20H,1-4,11H2,(H,12,17)(H,13,14)(H,15,16)(H,18,19);1-2H,(H,5,6,7)/t5-,6-;/m0./s1 |
| InChIKey | HDYZLCZJPJGSKO-GEMLJDPKSA-N |
| XLogP | -3.01 |
| TPSA | 204.99 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.40 |
| LogP ≤ 5 | -3.01 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|