C34H41NO12 — CID 21120817
[2-[4-[(2R,4S,5S,6S)-4-(dimethylamino)-5-hydroxy-6-methyloxan-2-yl]oxy-2,5,12-trihydroxy-7-methoxy-6,11-dioxo-3,4-dihydro-1H-tetracen-2-yl]-2-oxoethyl] pentanoate (PubChem CID 21120817) has the molecular formula C34H41NO12 and a molecular weight of 655.70 g/mol. Its IUPAC name is [2-[4-[(2R,4S,5S,6S)-4-(dimethylamino)-5-hydroxy-6-methyloxan-2-yl]oxy-2,5,12-trihydroxy-7-methoxy-6,11-dioxo-3,4-dihydro-1H-tetracen-2-yl]-2-oxoethyl] pentanoate.
| Compound Name | [2-[4-[(2R,4S,5S,6S)-4-(dimethylamino)-5-hydroxy-6-methyloxan-2-yl]oxy-2,5,12-trihydroxy-7-methoxy-6,11-dioxo-3,4-dihydro-1H-tetracen-2-yl]-2-oxoethyl] pentanoate |
|---|---|
| PubChem CID | 21120817 |
| Molecular Formula | C34H41NO12 |
| Molecular Weight | 655.70 g/mol |
| Exact Mass | 655.26 |
| IUPAC Name | [2-[4-[(2R,4S,5S,6S)-4-(dimethylamino)-5-hydroxy-6-methyloxan-2-yl]oxy-2,5,12-trihydroxy-7-methoxy-6,11-dioxo-3,4-dihydro-1H-tetracen-2-yl]-2-oxoethyl] pentanoate |
| SMILES | CCCCC(=O)OCC(=O)C1(O)Cc2c(O)c3c(c(O)c2C(O[C@H]2C[C@H](N(C)C)[C@H](O)[C@H](C)O2)C1)C(=O)c1c(OC)cccc1C3=O |
| InChI | InChI=1S/C34H41NO12/c1-6-7-11-23(37)45-15-22(36)34(43)13-18-26(21(14-34)47-24-12-19(35(3)4)29(38)16(2)46-24)33(42)28-27(31(18)40)30(39)17-9-8-10-20(44-5)25(17)32(28)41/h8-10,16,19,21,24,29,38,40,42-43H,6-7,11-15H2,1-5H3/t16-,19-,21?,24-,29+,34?/m0/s1 |
| InChIKey | OEDSRHSKPAYLBM-IDKNTEFWSA-N |
| XLogP | 2.35 |
| TPSA | 189.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.70 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|