C6H9F3O4S — CID 21121294
(2R,3S,4S)-2,3,4-trihydroxy-5-(trifluoromethylsulfanyl)pentanal (PubChem CID 21121294) has the molecular formula C6H9F3O4S and a molecular weight of 234.19 g/mol. Its IUPAC name is (2R,3S,4S)-2,3,4-trihydroxy-5-(trifluoromethylsulfanyl)pentanal.
| Compound Name | (2R,3S,4S)-2,3,4-trihydroxy-5-(trifluoromethylsulfanyl)pentanal |
|---|---|
| PubChem CID | 21121294 |
| Molecular Formula | C6H9F3O4S |
| Molecular Weight | 234.19 g/mol |
| Exact Mass | 234.02 |
| IUPAC Name | (2R,3S,4S)-2,3,4-trihydroxy-5-(trifluoromethylsulfanyl)pentanal |
| SMILES | O=C[C@H](O)[C@H](O)[C@H](O)CSC(F)(F)F |
| InChI | InChI=1S/C6H9F3O4S/c7-6(8,9)14-2-4(12)5(13)3(11)1-10/h1,3-5,11-13H,2H2/t3-,4+,5-/m0/s1 |
| InChIKey | KIBXDRNVLSBOGC-LMVFSUKVSA-N |
| XLogP | -0.48 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.19 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|