C20H34N4O4 — CID 21122343
methyl (2S)-2-[[(2S)-2-(decanoylamino)propanoyl]amino]-3-(1H-imidazol-5-yl)propanoate (PubChem CID 21122343) has the molecular formula C20H34N4O4 and a molecular weight of 394.52 g/mol. Its IUPAC name is methyl (2S)-2-[[(2S)-2-(decanoylamino)propanoyl]amino]-3-(1H-imidazol-5-yl)propanoate.
| Compound Name | methyl (2S)-2-[[(2S)-2-(decanoylamino)propanoyl]amino]-3-(1H-imidazol-5-yl)propanoate |
|---|---|
| PubChem CID | 21122343 |
| Molecular Formula | C20H34N4O4 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.26 |
| IUPAC Name | methyl (2S)-2-[[(2S)-2-(decanoylamino)propanoyl]amino]-3-(1H-imidazol-5-yl)propanoate |
| SMILES | CCCCCCCCCC(=O)N[C@@H](C)C(=O)N[C@@H](Cc1cnc[nH]1)C(=O)OC |
| InChI | InChI=1S/C20H34N4O4/c1-4-5-6-7-8-9-10-11-18(25)23-15(2)19(26)24-17(20(27)28-3)12-16-13-21-14-22-16/h13-15,17H,4-12H2,1-3H3,(H,21,22)(H,23,25)(H,24,26)/t15-,17-/m0/s1 |
| InChIKey | MJMCWQGJZURFBP-RDJZCZTQSA-N |
| XLogP | 2.26 |
| TPSA | 113.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|