About 2-[(2-chlorophenyl)methylsulfanyl]-N,N,5-trimethylpyrimidin-4-amine;hydrochloride
2-[(2-chlorophenyl)methylsulfanyl]-N,N,5-trimethylpyrimidin-4-amine;hydrochloride (PubChem CID 21122574) has the molecular formula C14H17Cl2N3S
and a molecular weight of 330.28 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methylsulfanyl]-N,N,5-trimethylpyrimidin-4-amine;hydrochloride.
Molecular Properties
| Compound Name | 2-[(2-chlorophenyl)methylsulfanyl]-N,N,5-trimethylpyrimidin-4-amine;hydrochloride |
| PubChem CID | 21122574 |
| Molecular Formula | C14H17Cl2N3S |
| Molecular Weight | 330.28 g/mol |
| Exact Mass | 329.05 |
| IUPAC Name | 2-[(2-chlorophenyl)methylsulfanyl]-N,N,5-trimethylpyrimidin-4-amine;hydrochloride |
| SMILES | Cc1cnc(SCc2ccccc2Cl)nc1N(C)C.Cl |
| InChI | InChI=1S/C14H16ClN3S.ClH/c1-10-8-16-14(17-13(10)18(2)3)19-9-11-6-4-5-7-12(11)15;/h4-8H,9H2,1-3H3;1H |
| InChIKey | DLDAOGLPDLBMBK-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.28 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(2-chlorophenyl)methylsulfanyl]-N,N,5-trimethylpyrimidin-4-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-chlorophenyl)methylsulfanyl]-N,N,5-trimethylpyrimidin-4-amine;hydrochloride?
The IUPAC name of 2-[(2-chlorophenyl)methylsulfanyl]-N,N,5-trimethylpyrimidin-4-amine;hydrochloride (CID 21122574) is 2-[(2-chlorophenyl)methylsulfanyl]-N,N,5-trimethylpyrimidin-4-amine;hydrochloride.
What is the SMILES notation for 2-[(2-chlorophenyl)methylsulfanyl]-N,N,5-trimethylpyrimidin-4-amine;hydrochloride?
The canonical SMILES for 2-[(2-chlorophenyl)methylsulfanyl]-N,N,5-trimethylpyrimidin-4-amine;hydrochloride is Cc1cnc(SCc2ccccc2Cl)nc1N(C)C.Cl.
What is the InChIKey of 2-[(2-chlorophenyl)methylsulfanyl]-N,N,5-trimethylpyrimidin-4-amine;hydrochloride?
The InChIKey is DLDAOGLPDLBMBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16ClN3S.ClH/c1-10-8-16-14(17-13(10)18(2)3)19-9-11-6-4-5-7-12(11)15;/h4-8H,9H2,1-3H3;1H.
What are the key properties of 2-[(2-chlorophenyl)methylsulfanyl]-N,N,5-trimethylpyrimidin-4-amine;hydrochloride?
2-[(2-chlorophenyl)methylsulfanyl]-N,N,5-trimethylpyrimidin-4-amine;hydrochloride has a molecular weight of 330.28 g/mol, XLogP of 4.22, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-chlorophenyl)methylsulfanyl]-N,N,5-trimethylpyrimidin-4-amine;hydrochloride is sourced from PubChem (CID 21122574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).