About N'-methyl-N'-prop-2-enylbutane-1,4-diamine
N'-methyl-N'-prop-2-enylbutane-1,4-diamine (PubChem CID 21122644) has the molecular formula C8H18N2
and a molecular weight of 142.25 g/mol. Its IUPAC name is N'-methyl-N'-prop-2-enylbutane-1,4-diamine.
Molecular Properties
| Compound Name | N'-methyl-N'-prop-2-enylbutane-1,4-diamine |
| PubChem CID | 21122644 |
| Molecular Formula | C8H18N2 |
| Molecular Weight | 142.25 g/mol |
| Exact Mass | 142.15 |
| IUPAC Name | N'-methyl-N'-prop-2-enylbutane-1,4-diamine |
| SMILES | C=CCN(C)CCCCN |
| InChI | InChI=1S/C8H18N2/c1-3-7-10(2)8-5-4-6-9/h3H,1,4-9H2,2H3 |
| InChIKey | CLNFWYZNUZHPII-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.25 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N'-methyl-N'-prop-2-enylbutane-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-methyl-N'-prop-2-enylbutane-1,4-diamine?
The IUPAC name of N'-methyl-N'-prop-2-enylbutane-1,4-diamine (CID 21122644) is N'-methyl-N'-prop-2-enylbutane-1,4-diamine.
What is the SMILES notation for N'-methyl-N'-prop-2-enylbutane-1,4-diamine?
The canonical SMILES for N'-methyl-N'-prop-2-enylbutane-1,4-diamine is C=CCN(C)CCCCN.
What is the InChIKey of N'-methyl-N'-prop-2-enylbutane-1,4-diamine?
The InChIKey is CLNFWYZNUZHPII-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N2/c1-3-7-10(2)8-5-4-6-9/h3H,1,4-9H2,2H3.
What are the key properties of N'-methyl-N'-prop-2-enylbutane-1,4-diamine?
N'-methyl-N'-prop-2-enylbutane-1,4-diamine has a molecular weight of 142.25 g/mol, XLogP of 0.84, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-methyl-N'-prop-2-enylbutane-1,4-diamine is sourced from PubChem (CID 21122644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).