About 2-(acridin-9-ylamino)benzenesulfonamide;hydrate;hydrochloride
2-(acridin-9-ylamino)benzenesulfonamide;hydrate;hydrochloride (PubChem CID 21123317) has the molecular formula C19H18ClN3O3S
and a molecular weight of 403.89 g/mol. Its IUPAC name is 2-(acridin-9-ylamino)benzenesulfonamide;hydrate;hydrochloride.
Molecular Properties
| Compound Name | 2-(acridin-9-ylamino)benzenesulfonamide;hydrate;hydrochloride |
| PubChem CID | 21123317 |
| Molecular Formula | C19H18ClN3O3S |
| Molecular Weight | 403.89 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | 2-(acridin-9-ylamino)benzenesulfonamide;hydrate;hydrochloride |
| SMILES | Cl.NS(=O)(=O)c1ccccc1Nc1c2ccccc2nc2ccccc12.O |
| InChI | InChI=1S/C19H15N3O2S.ClH.H2O/c20-25(23,24)18-12-6-5-11-17(18)22-19-13-7-1-3-9-15(13)21-16-10-4-2-8-14(16)19;;/h1-12H,(H,21,22)(H2,20,23,24);1H;1H2 |
| InChIKey | BAIRVCSJKBDDDC-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 116.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.89 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(acridin-9-ylamino)benzenesulfonamide;hydrate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(acridin-9-ylamino)benzenesulfonamide;hydrate;hydrochloride?
The IUPAC name of 2-(acridin-9-ylamino)benzenesulfonamide;hydrate;hydrochloride (CID 21123317) is 2-(acridin-9-ylamino)benzenesulfonamide;hydrate;hydrochloride.
What is the SMILES notation for 2-(acridin-9-ylamino)benzenesulfonamide;hydrate;hydrochloride?
The canonical SMILES for 2-(acridin-9-ylamino)benzenesulfonamide;hydrate;hydrochloride is Cl.NS(=O)(=O)c1ccccc1Nc1c2ccccc2nc2ccccc12.O.
What is the InChIKey of 2-(acridin-9-ylamino)benzenesulfonamide;hydrate;hydrochloride?
The InChIKey is BAIRVCSJKBDDDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15N3O2S.ClH.H2O/c20-25(23,24)18-12-6-5-11-17(18)22-19-13-7-1-3-9-15(13)21-16-10-4-2-8-14(16)19;;/h1-12H,(H,21,22)(H2,20,23,24);1H;1H2.
What are the key properties of 2-(acridin-9-ylamino)benzenesulfonamide;hydrate;hydrochloride?
2-(acridin-9-ylamino)benzenesulfonamide;hydrate;hydrochloride has a molecular weight of 403.89 g/mol, XLogP of 3.38, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(acridin-9-ylamino)benzenesulfonamide;hydrate;hydrochloride is sourced from PubChem (CID 21123317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).