C14H21ClN6Zn+2 — CID 21123925
zinc;4-[(2,4-dimethyl-1,2,4-triazol-4-ium-3-yl)diazenyl]-N,N-diethylaniline;chloride (PubChem CID 21123925) has the molecular formula C14H21ClN6Zn+2 and a molecular weight of 374.21 g/mol. Its IUPAC name is zinc;4-[(2,4-dimethyl-1,2,4-triazol-4-ium-3-yl)diazenyl]-N,N-diethylaniline;chloride.
| Compound Name | zinc;4-[(2,4-dimethyl-1,2,4-triazol-4-ium-3-yl)diazenyl]-N,N-diethylaniline;chloride |
|---|---|
| PubChem CID | 21123925 |
| Molecular Formula | C14H21ClN6Zn+2 |
| Molecular Weight | 374.21 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | zinc;4-[(2,4-dimethyl-1,2,4-triazol-4-ium-3-yl)diazenyl]-N,N-diethylaniline;chloride |
| SMILES | CCN(CC)c1ccc(/N=N/c2n(C)nc[n+]2C)cc1.[Cl-].[Zn+2] |
| InChI | InChI=1S/C14H21N6.ClH.Zn/c1-5-20(6-2)13-9-7-12(8-10-13)16-17-14-18(3)11-15-19(14)4;;/h7-11H,5-6H2,1-4H3;1H;/q+1;;+2/p-1 |
| InChIKey | XYWXCUKVAZXNMR-UHFFFAOYSA-M |
| XLogP | -0.49 |
| TPSA | 49.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.21 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|