About hexachloropalladium(2-);hydron
hexachloropalladium(2-);hydron (PubChem CID 21124042) has the molecular formula H2Cl6Pd
and a molecular weight of 321.15 g/mol. Its IUPAC name is hexachloropalladium(2-);hydron.
Molecular Properties
| Compound Name | hexachloropalladium(2-);hydron |
| PubChem CID | 21124042 |
| Molecular Formula | H2Cl6Pd |
| Molecular Weight | 321.15 g/mol |
| Exact Mass | 317.73 |
| IUPAC Name | hexachloropalladium(2-);hydron |
| SMILES | Cl[Pd-2](Cl)(Cl)(Cl)(Cl)Cl.[H+].[H+] |
| InChI | InChI=1S/6ClH.Pd/h6*1H;/q;;;;;;+4/p-4 |
| InChIKey | QVWOZVFUGLNYKZ-UHFFFAOYSA-J |
| XLogP | 4.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.15 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze hexachloropalladium(2-);hydron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexachloropalladium(2-);hydron?
The IUPAC name of hexachloropalladium(2-);hydron (CID 21124042) is hexachloropalladium(2-);hydron.
What is the SMILES notation for hexachloropalladium(2-);hydron?
The canonical SMILES for hexachloropalladium(2-);hydron is Cl[Pd-2](Cl)(Cl)(Cl)(Cl)Cl.[H+].[H+].
What is the InChIKey of hexachloropalladium(2-);hydron?
The InChIKey is QVWOZVFUGLNYKZ-UHFFFAOYSA-J. The full InChI is InChI=1S/6ClH.Pd/h6*1H;/q;;;;;;+4/p-4.
What are the key properties of hexachloropalladium(2-);hydron?
hexachloropalladium(2-);hydron has a molecular weight of 321.15 g/mol, XLogP of 4.36, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for hexachloropalladium(2-);hydron is sourced from PubChem (CID 21124042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).