About 4-anilino-8-chloro-3'-methylspiro[3,4-dihydro-1H-benzo[cd]indole-5,5'-furan]-2'-one
4-anilino-8-chloro-3'-methylspiro[3,4-dihydro-1H-benzo[cd]indole-5,5'-furan]-2'-one (PubChem CID 21124154) has the molecular formula C21H17ClN2O2
and a molecular weight of 364.83 g/mol. Its IUPAC name is 4-anilino-8-chloro-3'-methylspiro[3,4-dihydro-1H-benzo[cd]indole-5,5'-furan]-2'-one.
Molecular Properties
| Compound Name | 4-anilino-8-chloro-3'-methylspiro[3,4-dihydro-1H-benzo[cd]indole-5,5'-furan]-2'-one |
| PubChem CID | 21124154 |
| Molecular Formula | C21H17ClN2O2 |
| Molecular Weight | 364.83 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | 4-anilino-8-chloro-3'-methylspiro[3,4-dihydro-1H-benzo[cd]indole-5,5'-furan]-2'-one |
| SMILES | CC1=CC2(OC1=O)c1ccc(Cl)c3[nH]cc(c13)CC2Nc1ccccc1 |
| InChI | InChI=1S/C21H17ClN2O2/c1-12-10-21(26-20(12)25)15-7-8-16(22)19-18(15)13(11-23-19)9-17(21)24-14-5-3-2-4-6-14/h2-8,10-11,17,23-24H,9H2,1H3 |
| InChIKey | AAHWIRZTJUXCTR-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.83 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-anilino-8-chloro-3'-methylspiro[3,4-dihydro-1H-benzo[cd]indole-5,5'-furan]-2'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-anilino-8-chloro-3'-methylspiro[3,4-dihydro-1H-benzo[cd]indole-5,5'-furan]-2'-one?
The IUPAC name of 4-anilino-8-chloro-3'-methylspiro[3,4-dihydro-1H-benzo[cd]indole-5,5'-furan]-2'-one (CID 21124154) is 4-anilino-8-chloro-3'-methylspiro[3,4-dihydro-1H-benzo[cd]indole-5,5'-furan]-2'-one.
What is the SMILES notation for 4-anilino-8-chloro-3'-methylspiro[3,4-dihydro-1H-benzo[cd]indole-5,5'-furan]-2'-one?
The canonical SMILES for 4-anilino-8-chloro-3'-methylspiro[3,4-dihydro-1H-benzo[cd]indole-5,5'-furan]-2'-one is CC1=CC2(OC1=O)c1ccc(Cl)c3[nH]cc(c13)CC2Nc1ccccc1.
What is the InChIKey of 4-anilino-8-chloro-3'-methylspiro[3,4-dihydro-1H-benzo[cd]indole-5,5'-furan]-2'-one?
The InChIKey is AAHWIRZTJUXCTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17ClN2O2/c1-12-10-21(26-20(12)25)15-7-8-16(22)19-18(15)13(11-23-19)9-17(21)24-14-5-3-2-4-6-14/h2-8,10-11,17,23-24H,9H2,1H3.
What are the key properties of 4-anilino-8-chloro-3'-methylspiro[3,4-dihydro-1H-benzo[cd]indole-5,5'-furan]-2'-one?
4-anilino-8-chloro-3'-methylspiro[3,4-dihydro-1H-benzo[cd]indole-5,5'-furan]-2'-one has a molecular weight of 364.83 g/mol, XLogP of 4.56, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-anilino-8-chloro-3'-methylspiro[3,4-dihydro-1H-benzo[cd]indole-5,5'-furan]-2'-one is sourced from PubChem (CID 21124154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).