C35H55NO3 — CID 21124209
4-[2-[6,6,9-trimethyl-3-(3-methyloctan-2-yl)-7,8,9,10-tetrahydrobenzo[c]chromen-1-yl]azepan-1-yl]butanoic acid (PubChem CID 21124209) has the molecular formula C35H55NO3 and a molecular weight of 537.83 g/mol. Its IUPAC name is 4-[2-[6,6,9-trimethyl-3-(3-methyloctan-2-yl)-7,8,9,10-tetrahydrobenzo[c]chromen-1-yl]azepan-1-yl]butanoic acid.
| Compound Name | 4-[2-[6,6,9-trimethyl-3-(3-methyloctan-2-yl)-7,8,9,10-tetrahydrobenzo[c]chromen-1-yl]azepan-1-yl]butanoic acid |
|---|---|
| PubChem CID | 21124209 |
| Molecular Formula | C35H55NO3 |
| Molecular Weight | 537.83 g/mol |
| Exact Mass | 537.42 |
| IUPAC Name | 4-[2-[6,6,9-trimethyl-3-(3-methyloctan-2-yl)-7,8,9,10-tetrahydrobenzo[c]chromen-1-yl]azepan-1-yl]butanoic acid |
| SMILES | CCCCCC(C)C(C)c1cc2c(c(C3CCCCCN3CCCC(=O)O)c1)C1=C(CCC(C)C1)C(C)(C)O2 |
| InChI | InChI=1S/C35H55NO3/c1-7-8-10-14-25(3)26(4)27-22-29(31-15-11-9-12-19-36(31)20-13-16-33(37)38)34-28-21-24(2)17-18-30(28)35(5,6)39-32(34)23-27/h22-26,31H,7-21H2,1-6H3,(H,37,38) |
| InChIKey | DHKNQYCZXUTJRF-UHFFFAOYSA-N |
| XLogP | 9.53 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.83 |
| LogP ≤ 5 | 9.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|