About bis(2-[2-(2,6-dichlorophenoxy)ethylamino]guanidine);sulfuric acid
bis(2-[2-(2,6-dichlorophenoxy)ethylamino]guanidine);sulfuric acid (PubChem CID 21124335) has the molecular formula C18H26Cl4N8O6S
and a molecular weight of 624.34 g/mol. Its IUPAC name is bis(2-[2-(2,6-dichlorophenoxy)ethylamino]guanidine);sulfuric acid.
Molecular Properties
| Compound Name | bis(2-[2-(2,6-dichlorophenoxy)ethylamino]guanidine);sulfuric acid |
| PubChem CID | 21124335 |
| Molecular Formula | C18H26Cl4N8O6S |
| Molecular Weight | 624.34 g/mol |
| Exact Mass | 622.05 |
| IUPAC Name | bis(2-[2-(2,6-dichlorophenoxy)ethylamino]guanidine);sulfuric acid |
| SMILES | NC(N)=NNCCOc1c(Cl)cccc1Cl.NC(N)=NNCCOc1c(Cl)cccc1Cl.O=S(=O)(O)O |
| InChI | InChI=1S/2C9H12Cl2N4O.H2O4S/c2*10-6-2-1-3-7(11)8(6)16-5-4-14-15-9(12)13;1-5(2,3)4/h2*1-3,14H,4-5H2,(H4,12,13,15);(H2,1,2,3,4) |
| InChIKey | OLLMPVQGLMNQQK-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 245.92 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 624.34 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze bis(2-[2-(2,6-dichlorophenoxy)ethylamino]guanidine);sulfuric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-[2-(2,6-dichlorophenoxy)ethylamino]guanidine);sulfuric acid?
The IUPAC name of bis(2-[2-(2,6-dichlorophenoxy)ethylamino]guanidine);sulfuric acid (CID 21124335) is bis(2-[2-(2,6-dichlorophenoxy)ethylamino]guanidine);sulfuric acid.
What is the SMILES notation for bis(2-[2-(2,6-dichlorophenoxy)ethylamino]guanidine);sulfuric acid?
The canonical SMILES for bis(2-[2-(2,6-dichlorophenoxy)ethylamino]guanidine);sulfuric acid is NC(N)=NNCCOc1c(Cl)cccc1Cl.NC(N)=NNCCOc1c(Cl)cccc1Cl.O=S(=O)(O)O.
What is the InChIKey of bis(2-[2-(2,6-dichlorophenoxy)ethylamino]guanidine);sulfuric acid?
The InChIKey is OLLMPVQGLMNQQK-UHFFFAOYSA-N. The full InChI is InChI=1S/2C9H12Cl2N4O.H2O4S/c2*10-6-2-1-3-7(11)8(6)16-5-4-14-15-9(12)13;1-5(2,3)4/h2*1-3,14H,4-5H2,(H4,12,13,15);(H2,1,2,3,4).
What are the key properties of bis(2-[2-(2,6-dichlorophenoxy)ethylamino]guanidine);sulfuric acid?
bis(2-[2-(2,6-dichlorophenoxy)ethylamino]guanidine);sulfuric acid has a molecular weight of 624.34 g/mol, XLogP of 1.65, 10 rotatable bonds, 8 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-[2-(2,6-dichlorophenoxy)ethylamino]guanidine);sulfuric acid is sourced from PubChem (CID 21124335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).