C10H11N5O6 — CID 21124671
2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purine-6,8-dione (PubChem CID 21124671) has the molecular formula C10H11N5O6 and a molecular weight of 297.23 g/mol. Its IUPAC name is 2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purine-6,8-dione.
| Compound Name | 2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purine-6,8-dione |
|---|---|
| PubChem CID | 21124671 |
| Molecular Formula | C10H11N5O6 |
| Molecular Weight | 297.23 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | 2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purine-6,8-dione |
| SMILES | NC1=NC(=O)C2=NC(=O)N([C@@H]3O[C@H](CO)[C@@H](O)[C@H]3O)C2=N1 |
| InChI | InChI=1S/C10H11N5O6/c11-9-13-6-3(7(19)14-9)12-10(20)15(6)8-5(18)4(17)2(1-16)21-8/h2,4-5,8,16-18H,1H2,(H2,11,14,19)/t2-,4-,5-,8-/m1/s1 |
| InChIKey | MYDFOUUSSBDTNG-UMMCILCDSA-N |
| XLogP | -3.44 |
| TPSA | 170.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.23 |
| LogP ≤ 5 | -3.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |