About bis(2-methylpentane-2,4-diolate);titanium(4+)
bis(2-methylpentane-2,4-diolate);titanium(4+) (PubChem CID 21124890) has the molecular formula C12H24O4Ti
and a molecular weight of 280.19 g/mol. Its IUPAC name is bis(2-methylpentane-2,4-diolate);titanium(4+).
Molecular Properties
| Compound Name | bis(2-methylpentane-2,4-diolate);titanium(4+) |
| PubChem CID | 21124890 |
| Molecular Formula | C12H24O4Ti |
| Molecular Weight | 280.19 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | bis(2-methylpentane-2,4-diolate);titanium(4+) |
| SMILES | CC([O-])CC(C)(C)[O-].CC([O-])CC(C)(C)[O-].[Ti+4] |
| InChI | InChI=1S/2C6H12O2.Ti/c2*1-5(7)4-6(2,3)8;/h2*5H,4H2,1-3H3;/q2*-2;+4 |
| InChIKey | GSZUETAWERUDNK-UHFFFAOYSA-N |
| XLogP | -1.47 |
| TPSA | 92.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.19 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze bis(2-methylpentane-2,4-diolate);titanium(4+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-methylpentane-2,4-diolate);titanium(4+)?
The IUPAC name of bis(2-methylpentane-2,4-diolate);titanium(4+) (CID 21124890) is bis(2-methylpentane-2,4-diolate);titanium(4+).
What is the SMILES notation for bis(2-methylpentane-2,4-diolate);titanium(4+)?
The canonical SMILES for bis(2-methylpentane-2,4-diolate);titanium(4+) is CC([O-])CC(C)(C)[O-].CC([O-])CC(C)(C)[O-].[Ti+4].
What is the InChIKey of bis(2-methylpentane-2,4-diolate);titanium(4+)?
The InChIKey is GSZUETAWERUDNK-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H12O2.Ti/c2*1-5(7)4-6(2,3)8;/h2*5H,4H2,1-3H3;/q2*-2;+4.
What are the key properties of bis(2-methylpentane-2,4-diolate);titanium(4+)?
bis(2-methylpentane-2,4-diolate);titanium(4+) has a molecular weight of 280.19 g/mol, XLogP of -1.47, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-methylpentane-2,4-diolate);titanium(4+) is sourced from PubChem (CID 21124890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).