C6H10O12P2-4 — CID 21125049
[(2R,3S,4S)-3,4,5-trihydroxy-5-(phosphonatooxymethyl)oxolan-2-yl]methyl phosphate (PubChem CID 21125049) has the molecular formula C6H10O12P2-4 and a molecular weight of 336.08 g/mol. Its IUPAC name is [(2R,3S,4S)-3,4,5-trihydroxy-5-(phosphonatooxymethyl)oxolan-2-yl]methyl phosphate.
| Compound Name | [(2R,3S,4S)-3,4,5-trihydroxy-5-(phosphonatooxymethyl)oxolan-2-yl]methyl phosphate |
|---|---|
| PubChem CID | 21125049 |
| Molecular Formula | C6H10O12P2-4 |
| Molecular Weight | 336.08 g/mol |
| Exact Mass | 335.97 |
| IUPAC Name | [(2R,3S,4S)-3,4,5-trihydroxy-5-(phosphonatooxymethyl)oxolan-2-yl]methyl phosphate |
| SMILES | O=P([O-])([O-])OC[C@H]1OC(O)(COP(=O)([O-])[O-])[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H14O12P2/c7-4-3(1-16-19(10,11)12)18-6(9,5(4)8)2-17-20(13,14)15/h3-5,7-9H,1-2H2,(H2,10,11,12)(H2,13,14,15)/p-4/t3-,4-,5+,6?/m1/s1 |
| InChIKey | RNBGYGVWRKECFJ-VRPWFDPXSA-J |
| XLogP | -5.51 |
| TPSA | 214.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.08 |
| LogP ≤ 5 | -5.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|