About 2-cyanoacetate;2-hydroxypropyl(trimethyl)azanium
2-cyanoacetate;2-hydroxypropyl(trimethyl)azanium (PubChem CID 21125065) has the molecular formula C9H18N2O3
and a molecular weight of 202.25 g/mol. Its IUPAC name is 2-cyanoacetate;2-hydroxypropyl(trimethyl)azanium.
Molecular Properties
| Compound Name | 2-cyanoacetate;2-hydroxypropyl(trimethyl)azanium |
| PubChem CID | 21125065 |
| Molecular Formula | C9H18N2O3 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.13 |
| IUPAC Name | 2-cyanoacetate;2-hydroxypropyl(trimethyl)azanium |
| SMILES | CC(O)C[N+](C)(C)C.N#CCC(=O)[O-] |
| InChI | InChI=1S/C6H16NO.C3H3NO2/c1-6(8)5-7(2,3)4;4-2-1-3(5)6/h6,8H,5H2,1-4H3;1H2,(H,5,6)/q+1;/p-1 |
| InChIKey | NMRZRIUGGSTSEY-UHFFFAOYSA-M |
| XLogP | -1.28 |
| TPSA | 84.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-cyanoacetate;2-hydroxypropyl(trimethyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyanoacetate;2-hydroxypropyl(trimethyl)azanium?
The IUPAC name of 2-cyanoacetate;2-hydroxypropyl(trimethyl)azanium (CID 21125065) is 2-cyanoacetate;2-hydroxypropyl(trimethyl)azanium.
What is the SMILES notation for 2-cyanoacetate;2-hydroxypropyl(trimethyl)azanium?
The canonical SMILES for 2-cyanoacetate;2-hydroxypropyl(trimethyl)azanium is CC(O)C[N+](C)(C)C.N#CCC(=O)[O-].
What is the InChIKey of 2-cyanoacetate;2-hydroxypropyl(trimethyl)azanium?
The InChIKey is NMRZRIUGGSTSEY-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H16NO.C3H3NO2/c1-6(8)5-7(2,3)4;4-2-1-3(5)6/h6,8H,5H2,1-4H3;1H2,(H,5,6)/q+1;/p-1.
What are the key properties of 2-cyanoacetate;2-hydroxypropyl(trimethyl)azanium?
2-cyanoacetate;2-hydroxypropyl(trimethyl)azanium has a molecular weight of 202.25 g/mol, XLogP of -1.28, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyanoacetate;2-hydroxypropyl(trimethyl)azanium is sourced from PubChem (CID 21125065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).