C20H15NO4 — CID 21125620
1-nitro-7,8,9,10-tetrahydrobenzo[a]pyrene-7,8-diol (PubChem CID 21125620) has the molecular formula C20H15NO4 and a molecular weight of 333.34 g/mol. Its IUPAC name is 1-nitro-7,8,9,10-tetrahydrobenzo[a]pyrene-7,8-diol.
| Compound Name | 1-nitro-7,8,9,10-tetrahydrobenzo[a]pyrene-7,8-diol |
|---|---|
| PubChem CID | 21125620 |
| Molecular Formula | C20H15NO4 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | 1-nitro-7,8,9,10-tetrahydrobenzo[a]pyrene-7,8-diol |
| SMILES | O=[N+]([O-])c1ccc2ccc3cc4c(c5ccc1c2c35)CCC(O)C4O |
| InChI | InChI=1S/C20H15NO4/c22-17-8-6-12-13-4-5-14-16(21(24)25)7-3-10-1-2-11(19(13)18(10)14)9-15(12)20(17)23/h1-5,7,9,17,20,22-23H,6,8H2 |
| InChIKey | QTNIXPKSIXWXPR-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|