C18H22Cl2N2O2 — CID 21126731
2-(pyridin-3-ylmethylamino)ethyl 2-(4-chlorophenyl)-2-methylpropanoate;hydrochloride (PubChem CID 21126731) has the molecular formula C18H22Cl2N2O2 and a molecular weight of 369.29 g/mol. Its IUPAC name is 2-(pyridin-3-ylmethylamino)ethyl 2-(4-chlorophenyl)-2-methylpropanoate;hydrochloride.
| Compound Name | 2-(pyridin-3-ylmethylamino)ethyl 2-(4-chlorophenyl)-2-methylpropanoate;hydrochloride |
|---|---|
| PubChem CID | 21126731 |
| Molecular Formula | C18H22Cl2N2O2 |
| Molecular Weight | 369.29 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | 2-(pyridin-3-ylmethylamino)ethyl 2-(4-chlorophenyl)-2-methylpropanoate;hydrochloride |
| SMILES | CC(C)(C(=O)OCCNCc1cccnc1)c1ccc(Cl)cc1.Cl |
| InChI | InChI=1S/C18H21ClN2O2.ClH/c1-18(2,15-5-7-16(19)8-6-15)17(22)23-11-10-21-13-14-4-3-9-20-12-14;/h3-9,12,21H,10-11,13H2,1-2H3;1H |
| InChIKey | QGMNJYQYUDUDGJ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.29 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|