About 1-[2-(2-chlorophenothiazin-10-yl)cyclopropyl]-N,N-dimethylmethanamine;hydrochloride
1-[2-(2-chlorophenothiazin-10-yl)cyclopropyl]-N,N-dimethylmethanamine;hydrochloride (PubChem CID 21126901) has the molecular formula C18H20Cl2N2S
and a molecular weight of 367.35 g/mol. Its IUPAC name is 1-[2-(2-chlorophenothiazin-10-yl)cyclopropyl]-N,N-dimethylmethanamine;hydrochloride.
Molecular Properties
| Compound Name | 1-[2-(2-chlorophenothiazin-10-yl)cyclopropyl]-N,N-dimethylmethanamine;hydrochloride |
| PubChem CID | 21126901 |
| Molecular Formula | C18H20Cl2N2S |
| Molecular Weight | 367.35 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | 1-[2-(2-chlorophenothiazin-10-yl)cyclopropyl]-N,N-dimethylmethanamine;hydrochloride |
| SMILES | CN(C)CC1CC1N1c2ccccc2Sc2ccc(Cl)cc21.Cl |
| InChI | InChI=1S/C18H19ClN2S.ClH/c1-20(2)11-12-9-15(12)21-14-5-3-4-6-17(14)22-18-8-7-13(19)10-16(18)21;/h3-8,10,12,15H,9,11H2,1-2H3;1H |
| InChIKey | BGLVLGSVJCMVIK-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 367.35 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[2-(2-chlorophenothiazin-10-yl)cyclopropyl]-N,N-dimethylmethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(2-chlorophenothiazin-10-yl)cyclopropyl]-N,N-dimethylmethanamine;hydrochloride?
The IUPAC name of 1-[2-(2-chlorophenothiazin-10-yl)cyclopropyl]-N,N-dimethylmethanamine;hydrochloride (CID 21126901) is 1-[2-(2-chlorophenothiazin-10-yl)cyclopropyl]-N,N-dimethylmethanamine;hydrochloride.
What is the SMILES notation for 1-[2-(2-chlorophenothiazin-10-yl)cyclopropyl]-N,N-dimethylmethanamine;hydrochloride?
The canonical SMILES for 1-[2-(2-chlorophenothiazin-10-yl)cyclopropyl]-N,N-dimethylmethanamine;hydrochloride is CN(C)CC1CC1N1c2ccccc2Sc2ccc(Cl)cc21.Cl.
What is the InChIKey of 1-[2-(2-chlorophenothiazin-10-yl)cyclopropyl]-N,N-dimethylmethanamine;hydrochloride?
The InChIKey is BGLVLGSVJCMVIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19ClN2S.ClH/c1-20(2)11-12-9-15(12)21-14-5-3-4-6-17(14)22-18-8-7-13(19)10-16(18)21;/h3-8,10,12,15H,9,11H2,1-2H3;1H.
What are the key properties of 1-[2-(2-chlorophenothiazin-10-yl)cyclopropyl]-N,N-dimethylmethanamine;hydrochloride?
1-[2-(2-chlorophenothiazin-10-yl)cyclopropyl]-N,N-dimethylmethanamine;hydrochloride has a molecular weight of 367.35 g/mol, XLogP of 5.31, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(2-chlorophenothiazin-10-yl)cyclopropyl]-N,N-dimethylmethanamine;hydrochloride is sourced from PubChem (CID 21126901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).