About N-[2-(1-methylpyrrolidin-1-ium-1-yl)ethyl]-N-phenylaniline;bromide;hydrate
N-[2-(1-methylpyrrolidin-1-ium-1-yl)ethyl]-N-phenylaniline;bromide;hydrate (PubChem CID 21126988) has the molecular formula C19H27BrN2O
and a molecular weight of 379.34 g/mol. Its IUPAC name is N-[2-(1-methylpyrrolidin-1-ium-1-yl)ethyl]-N-phenylaniline;bromide;hydrate.
Molecular Properties
| Compound Name | N-[2-(1-methylpyrrolidin-1-ium-1-yl)ethyl]-N-phenylaniline;bromide;hydrate |
| PubChem CID | 21126988 |
| Molecular Formula | C19H27BrN2O |
| Molecular Weight | 379.34 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | N-[2-(1-methylpyrrolidin-1-ium-1-yl)ethyl]-N-phenylaniline;bromide;hydrate |
| SMILES | C[N+]1(CCN(c2ccccc2)c2ccccc2)CCCC1.O.[Br-] |
| InChI | InChI=1S/C19H25N2.BrH.H2O/c1-21(15-8-9-16-21)17-14-20(18-10-4-2-5-11-18)19-12-6-3-7-13-19;;/h2-7,10-13H,8-9,14-17H2,1H3;1H;1H2/q+1;;/p-1 |
| InChIKey | IVNGJGIUUZSRNL-UHFFFAOYSA-M |
| XLogP | 0.24 |
| TPSA | 34.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.34 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(1-methylpyrrolidin-1-ium-1-yl)ethyl]-N-phenylaniline;bromide;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(1-methylpyrrolidin-1-ium-1-yl)ethyl]-N-phenylaniline;bromide;hydrate?
The IUPAC name of N-[2-(1-methylpyrrolidin-1-ium-1-yl)ethyl]-N-phenylaniline;bromide;hydrate (CID 21126988) is N-[2-(1-methylpyrrolidin-1-ium-1-yl)ethyl]-N-phenylaniline;bromide;hydrate.
What is the SMILES notation for N-[2-(1-methylpyrrolidin-1-ium-1-yl)ethyl]-N-phenylaniline;bromide;hydrate?
The canonical SMILES for N-[2-(1-methylpyrrolidin-1-ium-1-yl)ethyl]-N-phenylaniline;bromide;hydrate is C[N+]1(CCN(c2ccccc2)c2ccccc2)CCCC1.O.[Br-].
What is the InChIKey of N-[2-(1-methylpyrrolidin-1-ium-1-yl)ethyl]-N-phenylaniline;bromide;hydrate?
The InChIKey is IVNGJGIUUZSRNL-UHFFFAOYSA-M. The full InChI is InChI=1S/C19H25N2.BrH.H2O/c1-21(15-8-9-16-21)17-14-20(18-10-4-2-5-11-18)19-12-6-3-7-13-19;;/h2-7,10-13H,8-9,14-17H2,1H3;1H;1H2/q+1;;/p-1.
What are the key properties of N-[2-(1-methylpyrrolidin-1-ium-1-yl)ethyl]-N-phenylaniline;bromide;hydrate?
N-[2-(1-methylpyrrolidin-1-ium-1-yl)ethyl]-N-phenylaniline;bromide;hydrate has a molecular weight of 379.34 g/mol, XLogP of 0.24, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(1-methylpyrrolidin-1-ium-1-yl)ethyl]-N-phenylaniline;bromide;hydrate is sourced from PubChem (CID 21126988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).