About (1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-ol;2-phenylacetic acid;hydrochloride
(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-ol;2-phenylacetic acid;hydrochloride (PubChem CID 21127000) has the molecular formula C16H24ClNO3
and a molecular weight of 313.82 g/mol. Its IUPAC name is (1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-ol;2-phenylacetic acid;hydrochloride.
Molecular Properties
| Compound Name | (1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-ol;2-phenylacetic acid;hydrochloride |
| PubChem CID | 21127000 |
| Molecular Formula | C16H24ClNO3 |
| Molecular Weight | 313.82 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | (1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-ol;2-phenylacetic acid;hydrochloride |
| SMILES | CN1[C@@H]2CC[C@H]1CC(O)C2.Cl.O=C(O)Cc1ccccc1 |
| InChI | InChI=1S/C8H15NO.C8H8O2.ClH/c1-9-6-2-3-7(9)5-8(10)4-6;9-8(10)6-7-4-2-1-3-5-7;/h6-8,10H,2-5H2,1H3;1-5H,6H2,(H,9,10);1H/t6-,7+,8?;; |
| InChIKey | IHKCTTQSXIESHP-VOAUATQSSA-N |
| XLogP | 2.34 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.82 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-ol;2-phenylacetic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-ol;2-phenylacetic acid;hydrochloride?
The IUPAC name of (1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-ol;2-phenylacetic acid;hydrochloride (CID 21127000) is (1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-ol;2-phenylacetic acid;hydrochloride.
What is the SMILES notation for (1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-ol;2-phenylacetic acid;hydrochloride?
The canonical SMILES for (1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-ol;2-phenylacetic acid;hydrochloride is CN1[C@@H]2CC[C@H]1CC(O)C2.Cl.O=C(O)Cc1ccccc1.
What is the InChIKey of (1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-ol;2-phenylacetic acid;hydrochloride?
The InChIKey is IHKCTTQSXIESHP-VOAUATQSSA-N. The full InChI is InChI=1S/C8H15NO.C8H8O2.ClH/c1-9-6-2-3-7(9)5-8(10)4-6;9-8(10)6-7-4-2-1-3-5-7;/h6-8,10H,2-5H2,1H3;1-5H,6H2,(H,9,10);1H/t6-,7+,8?;;.
What are the key properties of (1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-ol;2-phenylacetic acid;hydrochloride?
(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-ol;2-phenylacetic acid;hydrochloride has a molecular weight of 313.82 g/mol, XLogP of 2.34, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-ol;2-phenylacetic acid;hydrochloride is sourced from PubChem (CID 21127000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).