C17H12ClF3N2O2 — CID 2112714
(3R)-1-(2-chlorophenyl)-3-[3-(trifluoromethyl)anilino]pyrrolidine-2,5-dione (PubChem CID 2112714) has the molecular formula C17H12ClF3N2O2 and a molecular weight of 368.74 g/mol. Its IUPAC name is (3R)-1-(2-chlorophenyl)-3-[3-(trifluoromethyl)anilino]pyrrolidine-2,5-dione.
| Compound Name | (3R)-1-(2-chlorophenyl)-3-[3-(trifluoromethyl)anilino]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 2112714 |
| Molecular Formula | C17H12ClF3N2O2 |
| Molecular Weight | 368.74 g/mol |
| Exact Mass | 368.05 |
| IUPAC Name | (3R)-1-(2-chlorophenyl)-3-[3-(trifluoromethyl)anilino]pyrrolidine-2,5-dione |
| SMILES | O=C1C[C@@H](Nc2cccc(C(F)(F)F)c2)C(=O)N1c1ccccc1Cl |
| InChI | InChI=1S/C17H12ClF3N2O2/c18-12-6-1-2-7-14(12)23-15(24)9-13(16(23)25)22-11-5-3-4-10(8-11)17(19,20)21/h1-8,13,22H,9H2/t13-/m1/s1 |
| InChIKey | LNSXDUVDFRFGJY-CYBMUJFWSA-N |
| XLogP | 4.10 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.74 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|