About 4-(3-amino-1,5-dichloropentan-3-yl)-1,5-dimethyl-2-phenylpyrazol-3-one;hydrochloride
4-(3-amino-1,5-dichloropentan-3-yl)-1,5-dimethyl-2-phenylpyrazol-3-one;hydrochloride (PubChem CID 21127156) has the molecular formula C16H22Cl3N3O
and a molecular weight of 378.73 g/mol. Its IUPAC name is 4-(3-amino-1,5-dichloropentan-3-yl)-1,5-dimethyl-2-phenylpyrazol-3-one;hydrochloride.
Molecular Properties
| Compound Name | 4-(3-amino-1,5-dichloropentan-3-yl)-1,5-dimethyl-2-phenylpyrazol-3-one;hydrochloride |
| PubChem CID | 21127156 |
| Molecular Formula | C16H22Cl3N3O |
| Molecular Weight | 378.73 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | 4-(3-amino-1,5-dichloropentan-3-yl)-1,5-dimethyl-2-phenylpyrazol-3-one;hydrochloride |
| SMILES | Cc1c(C(N)(CCCl)CCCl)c(=O)n(-c2ccccc2)n1C.Cl |
| InChI | InChI=1S/C16H21Cl2N3O.ClH/c1-12-14(16(19,8-10-17)9-11-18)15(22)21(20(12)2)13-6-4-3-5-7-13;/h3-7H,8-11,19H2,1-2H3;1H |
| InChIKey | GWZLYKJNGOVRBJ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 52.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.73 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(3-amino-1,5-dichloropentan-3-yl)-1,5-dimethyl-2-phenylpyrazol-3-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-amino-1,5-dichloropentan-3-yl)-1,5-dimethyl-2-phenylpyrazol-3-one;hydrochloride?
The IUPAC name of 4-(3-amino-1,5-dichloropentan-3-yl)-1,5-dimethyl-2-phenylpyrazol-3-one;hydrochloride (CID 21127156) is 4-(3-amino-1,5-dichloropentan-3-yl)-1,5-dimethyl-2-phenylpyrazol-3-one;hydrochloride.
What is the SMILES notation for 4-(3-amino-1,5-dichloropentan-3-yl)-1,5-dimethyl-2-phenylpyrazol-3-one;hydrochloride?
The canonical SMILES for 4-(3-amino-1,5-dichloropentan-3-yl)-1,5-dimethyl-2-phenylpyrazol-3-one;hydrochloride is Cc1c(C(N)(CCCl)CCCl)c(=O)n(-c2ccccc2)n1C.Cl.
What is the InChIKey of 4-(3-amino-1,5-dichloropentan-3-yl)-1,5-dimethyl-2-phenylpyrazol-3-one;hydrochloride?
The InChIKey is GWZLYKJNGOVRBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21Cl2N3O.ClH/c1-12-14(16(19,8-10-17)9-11-18)15(22)21(20(12)2)13-6-4-3-5-7-13;/h3-7H,8-11,19H2,1-2H3;1H.
What are the key properties of 4-(3-amino-1,5-dichloropentan-3-yl)-1,5-dimethyl-2-phenylpyrazol-3-one;hydrochloride?
4-(3-amino-1,5-dichloropentan-3-yl)-1,5-dimethyl-2-phenylpyrazol-3-one;hydrochloride has a molecular weight of 378.73 g/mol, XLogP of 3.32, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-amino-1,5-dichloropentan-3-yl)-1,5-dimethyl-2-phenylpyrazol-3-one;hydrochloride is sourced from PubChem (CID 21127156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).