C21H48N6O6 — CID 21127168
2,2,4,4,6,6-hexakis(ethoxymethyl)-1,3,5-triazinane-1,3,5-triamine (PubChem CID 21127168) has the molecular formula C21H48N6O6 and a molecular weight of 480.65 g/mol. Its IUPAC name is 2,2,4,4,6,6-hexakis(ethoxymethyl)-1,3,5-triazinane-1,3,5-triamine.
| Compound Name | 2,2,4,4,6,6-hexakis(ethoxymethyl)-1,3,5-triazinane-1,3,5-triamine |
|---|---|
| PubChem CID | 21127168 |
| Molecular Formula | C21H48N6O6 |
| Molecular Weight | 480.65 g/mol |
| Exact Mass | 480.36 |
| IUPAC Name | 2,2,4,4,6,6-hexakis(ethoxymethyl)-1,3,5-triazinane-1,3,5-triamine |
| SMILES | CCOCC1(COCC)N(N)C(COCC)(COCC)N(N)C(COCC)(COCC)N1N |
| InChI | InChI=1S/C21H48N6O6/c1-7-28-13-19(14-29-8-2)25(22)20(15-30-9-3,16-31-10-4)27(24)21(26(19)23,17-32-11-5)18-33-12-6/h7-18,22-24H2,1-6H3 |
| InChIKey | DHEGKYQETYXAGO-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 143.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.65 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|