C47H49N5O8S2 — CID 21127283
2-N,5-N-bis(1-butylquinolin-1-ium-6-yl)pyridine-2,5-dicarboxamide;bis(4-methylbenzenesulfonate) (PubChem CID 21127283) has the molecular formula C47H49N5O8S2 and a molecular weight of 876.07 g/mol. Its IUPAC name is 2-N,5-N-bis(1-butylquinolin-1-ium-6-yl)pyridine-2,5-dicarboxamide;bis(4-methylbenzenesulfonate).
| Compound Name | 2-N,5-N-bis(1-butylquinolin-1-ium-6-yl)pyridine-2,5-dicarboxamide;bis(4-methylbenzenesulfonate) |
|---|---|
| PubChem CID | 21127283 |
| Molecular Formula | C47H49N5O8S2 |
| Molecular Weight | 876.07 g/mol |
| Exact Mass | 875.30 |
| IUPAC Name | 2-N,5-N-bis(1-butylquinolin-1-ium-6-yl)pyridine-2,5-dicarboxamide;bis(4-methylbenzenesulfonate) |
| SMILES | CCCC[n+]1cccc2cc(NC(=O)c3ccc(C(=O)Nc4ccc5c(ccc[n+]5CCCC)c4)nc3)ccc21.Cc1ccc(S(=O)(=O)[O-])cc1.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C33H33N5O2.2C7H8O3S/c1-3-5-17-37-19-7-9-24-21-27(12-15-30(24)37)35-32(39)26-11-14-29(34-23-26)33(40)36-28-13-16-31-25(22-28)10-8-20-38(31)18-6-4-2;2*1-6-2-4-7(5-3-6)11(8,9)10/h7-16,19-23H,3-6,17-18H2,1-2H3;2*2-5H,1H3,(H,8,9,10) |
| InChIKey | PAPNLGQEZMCYQW-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 193.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 876.07 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|