About S-(4-methylpiperazin-1-yl) 2-(6,11-dihydrobenzo[c][1]benzothiepin-2-yl)ethanethioate
S-(4-methylpiperazin-1-yl) 2-(6,11-dihydrobenzo[c][1]benzothiepin-2-yl)ethanethioate (PubChem CID 21127616) has the molecular formula C21H24N2OS2
and a molecular weight of 384.57 g/mol. Its IUPAC name is S-(4-methylpiperazin-1-yl) 2-(6,11-dihydrobenzo[c][1]benzothiepin-2-yl)ethanethioate.
Molecular Properties
| Compound Name | S-(4-methylpiperazin-1-yl) 2-(6,11-dihydrobenzo[c][1]benzothiepin-2-yl)ethanethioate |
| PubChem CID | 21127616 |
| Molecular Formula | C21H24N2OS2 |
| Molecular Weight | 384.57 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | S-(4-methylpiperazin-1-yl) 2-(6,11-dihydrobenzo[c][1]benzothiepin-2-yl)ethanethioate |
| SMILES | CN1CCN(SC(=O)Cc2ccc3c(c2)Cc2ccccc2CS3)CC1 |
| InChI | InChI=1S/C21H24N2OS2/c1-22-8-10-23(11-9-22)26-21(24)13-16-6-7-20-19(12-16)14-17-4-2-3-5-18(17)15-25-20/h2-7,12H,8-11,13-15H2,1H3 |
| InChIKey | QGIOWCFNYLWQNQ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.57 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(4-methylpiperazin-1-yl) 2-(6,11-dihydrobenzo[c][1]benzothiepin-2-yl)ethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(4-methylpiperazin-1-yl) 2-(6,11-dihydrobenzo[c][1]benzothiepin-2-yl)ethanethioate?
The IUPAC name of S-(4-methylpiperazin-1-yl) 2-(6,11-dihydrobenzo[c][1]benzothiepin-2-yl)ethanethioate (CID 21127616) is S-(4-methylpiperazin-1-yl) 2-(6,11-dihydrobenzo[c][1]benzothiepin-2-yl)ethanethioate.
What is the SMILES notation for S-(4-methylpiperazin-1-yl) 2-(6,11-dihydrobenzo[c][1]benzothiepin-2-yl)ethanethioate?
The canonical SMILES for S-(4-methylpiperazin-1-yl) 2-(6,11-dihydrobenzo[c][1]benzothiepin-2-yl)ethanethioate is CN1CCN(SC(=O)Cc2ccc3c(c2)Cc2ccccc2CS3)CC1.
What is the InChIKey of S-(4-methylpiperazin-1-yl) 2-(6,11-dihydrobenzo[c][1]benzothiepin-2-yl)ethanethioate?
The InChIKey is QGIOWCFNYLWQNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24N2OS2/c1-22-8-10-23(11-9-22)26-21(24)13-16-6-7-20-19(12-16)14-17-4-2-3-5-18(17)15-25-20/h2-7,12H,8-11,13-15H2,1H3.
What are the key properties of S-(4-methylpiperazin-1-yl) 2-(6,11-dihydrobenzo[c][1]benzothiepin-2-yl)ethanethioate?
S-(4-methylpiperazin-1-yl) 2-(6,11-dihydrobenzo[c][1]benzothiepin-2-yl)ethanethioate has a molecular weight of 384.57 g/mol, XLogP of 3.85, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for S-(4-methylpiperazin-1-yl) 2-(6,11-dihydrobenzo[c][1]benzothiepin-2-yl)ethanethioate is sourced from PubChem (CID 21127616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).