C15H16N2O5S2 — CID 21127802
[11-(hydroxymethyl)-15-methyl-10,14-dioxo-12,13-dithia-9,15-diazatetracyclo[9.2.2.01,9.03,8]pentadeca-3,5-dien-7-yl] acetate (PubChem CID 21127802) has the molecular formula C15H16N2O5S2 and a molecular weight of 368.44 g/mol. Its IUPAC name is [11-(hydroxymethyl)-15-methyl-10,14-dioxo-12,13-dithia-9,15-diazatetracyclo[9.2.2.01,9.03,8]pentadeca-3,5-dien-7-yl] acetate.
| Compound Name | [11-(hydroxymethyl)-15-methyl-10,14-dioxo-12,13-dithia-9,15-diazatetracyclo[9.2.2.01,9.03,8]pentadeca-3,5-dien-7-yl] acetate |
|---|---|
| PubChem CID | 21127802 |
| Molecular Formula | C15H16N2O5S2 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.05 |
| IUPAC Name | [11-(hydroxymethyl)-15-methyl-10,14-dioxo-12,13-dithia-9,15-diazatetracyclo[9.2.2.01,9.03,8]pentadeca-3,5-dien-7-yl] acetate |
| SMILES | CC(=O)OC1C=CC=C2CC34SSC(CO)(C(=O)N3C21)N(C)C4=O |
| InChI | InChI=1S/C15H16N2O5S2/c1-8(19)22-10-5-3-4-9-6-14-12(20)16(2)15(7-18,24-23-14)13(21)17(14)11(9)10/h3-5,10-11,18H,6-7H2,1-2H3 |
| InChIKey | ANMNRGVATKMYOR-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|