About 9,10-dimethylphenanthridine-2,7-diamine
9,10-dimethylphenanthridine-2,7-diamine (PubChem CID 21127949) has the molecular formula C15H15N3
and a molecular weight of 237.31 g/mol. Its IUPAC name is 9,10-dimethylphenanthridine-2,7-diamine.
Molecular Properties
| Compound Name | 9,10-dimethylphenanthridine-2,7-diamine |
| PubChem CID | 21127949 |
| Molecular Formula | C15H15N3 |
| Molecular Weight | 237.31 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | 9,10-dimethylphenanthridine-2,7-diamine |
| SMILES | Cc1cc(N)c2cnc3ccc(N)cc3c2c1C |
| InChI | InChI=1S/C15H15N3/c1-8-5-13(17)12-7-18-14-4-3-10(16)6-11(14)15(12)9(8)2/h3-7H,16-17H2,1-2H3 |
| InChIKey | UBXRYGSGXUIHFQ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.31 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 9,10-dimethylphenanthridine-2,7-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9,10-dimethylphenanthridine-2,7-diamine?
The IUPAC name of 9,10-dimethylphenanthridine-2,7-diamine (CID 21127949) is 9,10-dimethylphenanthridine-2,7-diamine.
What is the SMILES notation for 9,10-dimethylphenanthridine-2,7-diamine?
The canonical SMILES for 9,10-dimethylphenanthridine-2,7-diamine is Cc1cc(N)c2cnc3ccc(N)cc3c2c1C.
What is the InChIKey of 9,10-dimethylphenanthridine-2,7-diamine?
The InChIKey is UBXRYGSGXUIHFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N3/c1-8-5-13(17)12-7-18-14-4-3-10(16)6-11(14)15(12)9(8)2/h3-7H,16-17H2,1-2H3.
What are the key properties of 9,10-dimethylphenanthridine-2,7-diamine?
9,10-dimethylphenanthridine-2,7-diamine has a molecular weight of 237.31 g/mol, XLogP of 3.17, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9,10-dimethylphenanthridine-2,7-diamine is sourced from PubChem (CID 21127949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).