C44H44N10O8S2 — CID 21128063
1-N,4-N-bis[4-(2,4-diamino-1-methylpyrimidin-1-ium-5-yl)phenyl]benzene-1,4-dicarboxamide;bis(4-methylbenzenesulfonate) (PubChem CID 21128063) has the molecular formula C44H44N10O8S2 and a molecular weight of 905.03 g/mol. Its IUPAC name is 1-N,4-N-bis[4-(2,4-diamino-1-methylpyrimidin-1-ium-5-yl)phenyl]benzene-1,4-dicarboxamide;bis(4-methylbenzenesulfonate).
| Compound Name | 1-N,4-N-bis[4-(2,4-diamino-1-methylpyrimidin-1-ium-5-yl)phenyl]benzene-1,4-dicarboxamide;bis(4-methylbenzenesulfonate) |
|---|---|
| PubChem CID | 21128063 |
| Molecular Formula | C44H44N10O8S2 |
| Molecular Weight | 905.03 g/mol |
| Exact Mass | 904.28 |
| IUPAC Name | 1-N,4-N-bis[4-(2,4-diamino-1-methylpyrimidin-1-ium-5-yl)phenyl]benzene-1,4-dicarboxamide;bis(4-methylbenzenesulfonate) |
| SMILES | C[n+]1cc(-c2ccc(NC(=O)c3ccc(C(=O)Nc4ccc(-c5c[n+](C)c(N)nc5N)cc4)cc3)cc2)c(N)nc1N.Cc1ccc(S(=O)(=O)[O-])cc1.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C30H28N10O2.2C7H8O3S/c1-39-15-23(25(31)37-29(39)33)17-7-11-21(12-8-17)35-27(41)19-3-5-20(6-4-19)28(42)36-22-13-9-18(10-14-22)24-16-40(2)30(34)38-26(24)32;2*1-6-2-4-7(5-3-6)11(8,9)10/h3-16H,1-2H3,(H8,31,32,33,34,35,36,37,38,41,42);2*2-5H,1H3,(H,8,9,10) |
| InChIKey | WFRLSCOXQDCJRZ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 310.22 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 905.03 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|