C11H22N2O3 — CID 21128423
3-(aziridin-1-yl)propanoic acid;1-methylpiperidin-3-ol (PubChem CID 21128423) has the molecular formula C11H22N2O3 and a molecular weight of 230.31 g/mol. Its IUPAC name is 3-(aziridin-1-yl)propanoic acid;1-methylpiperidin-3-ol.
| Compound Name | 3-(aziridin-1-yl)propanoic acid;1-methylpiperidin-3-ol |
|---|---|
| PubChem CID | 21128423 |
| Molecular Formula | C11H22N2O3 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.16 |
| IUPAC Name | 3-(aziridin-1-yl)propanoic acid;1-methylpiperidin-3-ol |
| SMILES | CN1CCCC(O)C1.O=C(O)CCN1CC1 |
| InChI | InChI=1S/C6H13NO.C5H9NO2/c1-7-4-2-3-6(8)5-7;7-5(8)1-2-6-3-4-6/h6,8H,2-5H2,1H3;1-4H2,(H,7,8) |
| InChIKey | HUBHTMAYJBYZDY-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 63.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|