C9H14ClN3O3S — CID 21128674
2-hydroxy-2-[3-(methanesulfonamido)phenyl]ethanimidamide;hydrochloride (PubChem CID 21128674) has the molecular formula C9H14ClN3O3S and a molecular weight of 279.75 g/mol. Its IUPAC name is 2-hydroxy-2-[3-(methanesulfonamido)phenyl]ethanimidamide;hydrochloride.
| Compound Name | 2-hydroxy-2-[3-(methanesulfonamido)phenyl]ethanimidamide;hydrochloride |
|---|---|
| PubChem CID | 21128674 |
| Molecular Formula | C9H14ClN3O3S |
| Molecular Weight | 279.75 g/mol |
| Exact Mass | 279.04 |
| IUPAC Name | 2-hydroxy-2-[3-(methanesulfonamido)phenyl]ethanimidamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)C(O)c1cccc(NS(C)(=O)=O)c1 |
| InChI | InChI=1S/C9H13N3O3S.ClH/c1-16(14,15)12-7-4-2-3-6(5-7)8(13)9(10)11;/h2-5,8,12-13H,1H3,(H3,10,11);1H |
| InChIKey | VRGMOWGYZCODJP-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 116.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.75 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|