C26H34O6 — CID 21129097
(1S,5R,6R)-5-[(1R)-1,2-dihydroxyethyl]-3,7-bis(4-propan-2-ylphenyl)-2,4-dioxabicyclo[4.2.0]octane-6,8-diol (PubChem CID 21129097) has the molecular formula C26H34O6 and a molecular weight of 442.55 g/mol. Its IUPAC name is (1S,5R,6R)-5-[(1R)-1,2-dihydroxyethyl]-3,7-bis(4-propan-2-ylphenyl)-2,4-dioxabicyclo[4.2.0]octane-6,8-diol.
| Compound Name | (1S,5R,6R)-5-[(1R)-1,2-dihydroxyethyl]-3,7-bis(4-propan-2-ylphenyl)-2,4-dioxabicyclo[4.2.0]octane-6,8-diol |
|---|---|
| PubChem CID | 21129097 |
| Molecular Formula | C26H34O6 |
| Molecular Weight | 442.55 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | (1S,5R,6R)-5-[(1R)-1,2-dihydroxyethyl]-3,7-bis(4-propan-2-ylphenyl)-2,4-dioxabicyclo[4.2.0]octane-6,8-diol |
| SMILES | CC(C)c1ccc(C2O[C@H]([C@H](O)CO)[C@@]3(O)C(c4ccc(C(C)C)cc4)C(O)[C@@H]3O2)cc1 |
| InChI | InChI=1S/C26H34O6/c1-14(2)16-5-9-18(10-6-16)21-22(29)24-26(21,30)23(20(28)13-27)31-25(32-24)19-11-7-17(8-12-19)15(3)4/h5-12,14-15,20-25,27-30H,13H2,1-4H3/t20-,21?,22?,23-,24+,25?,26+/m1/s1 |
| InChIKey | DKQWSKSHCMWXLX-NNJHIOMWSA-N |
| XLogP | 2.96 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.55 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |