C24H29ClN4O4S2 — CID 2112964
4-[3-[4-[(2S)-butan-2-yl]-5-[2-(3-chlorophenoxy)ethylsulfanyl]-1,2,4-triazol-3-yl]phenyl]sulfonylmorpholine (PubChem CID 2112964) has the molecular formula C24H29ClN4O4S2 and a molecular weight of 537.11 g/mol. Its IUPAC name is 4-[3-[4-[(2S)-butan-2-yl]-5-[2-(3-chlorophenoxy)ethylsulfanyl]-1,2,4-triazol-3-yl]phenyl]sulfonylmorpholine.
| Compound Name | 4-[3-[4-[(2S)-butan-2-yl]-5-[2-(3-chlorophenoxy)ethylsulfanyl]-1,2,4-triazol-3-yl]phenyl]sulfonylmorpholine |
|---|---|
| PubChem CID | 2112964 |
| Molecular Formula | C24H29ClN4O4S2 |
| Molecular Weight | 537.11 g/mol |
| Exact Mass | 536.13 |
| IUPAC Name | 4-[3-[4-[(2S)-butan-2-yl]-5-[2-(3-chlorophenoxy)ethylsulfanyl]-1,2,4-triazol-3-yl]phenyl]sulfonylmorpholine |
| SMILES | CC[C@H](C)n1c(SCCOc2cccc(Cl)c2)nnc1-c1cccc(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C24H29ClN4O4S2/c1-3-18(2)29-23(26-27-24(29)34-15-14-33-21-8-5-7-20(25)17-21)19-6-4-9-22(16-19)35(30,31)28-10-12-32-13-11-28/h4-9,16-18H,3,10-15H2,1-2H3/t18-/m0/s1 |
| InChIKey | GKEDHZWLKBFXIJ-SFHVURJKSA-N |
| XLogP | 4.76 |
| TPSA | 86.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.11 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|