C11H15F6N3O2 — CID 21130156
2,2,2-trifluoro-1-[4-methyl-7-(2,2,2-trifluoroacetyl)-1,4,7-triazonan-1-yl]ethanone (PubChem CID 21130156) has the molecular formula C11H15F6N3O2 and a molecular weight of 335.25 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[4-methyl-7-(2,2,2-trifluoroacetyl)-1,4,7-triazonan-1-yl]ethanone.
| Compound Name | 2,2,2-trifluoro-1-[4-methyl-7-(2,2,2-trifluoroacetyl)-1,4,7-triazonan-1-yl]ethanone |
|---|---|
| PubChem CID | 21130156 |
| Molecular Formula | C11H15F6N3O2 |
| Molecular Weight | 335.25 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | 2,2,2-trifluoro-1-[4-methyl-7-(2,2,2-trifluoroacetyl)-1,4,7-triazonan-1-yl]ethanone |
| SMILES | CN1CCN(C(=O)C(F)(F)F)CCN(C(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C11H15F6N3O2/c1-18-2-4-19(8(21)10(12,13)14)6-7-20(5-3-18)9(22)11(15,16)17/h2-7H2,1H3 |
| InChIKey | UMTSFISBPRWZED-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.25 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |