C38H50N2O4P2 — CID 21130844
[2,4-ditert-butyl-6-(3,5-ditert-butyl-2-pyridin-3-yloxyphosphanyloxyphenyl)phenoxy]-pyridin-3-yloxyphosphane (PubChem CID 21130844) has the molecular formula C38H50N2O4P2 and a molecular weight of 660.78 g/mol. Its IUPAC name is [2,4-ditert-butyl-6-(3,5-ditert-butyl-2-pyridin-3-yloxyphosphanyloxyphenyl)phenoxy]-pyridin-3-yloxyphosphane.
| Compound Name | [2,4-ditert-butyl-6-(3,5-ditert-butyl-2-pyridin-3-yloxyphosphanyloxyphenyl)phenoxy]-pyridin-3-yloxyphosphane |
|---|---|
| PubChem CID | 21130844 |
| Molecular Formula | C38H50N2O4P2 |
| Molecular Weight | 660.78 g/mol |
| Exact Mass | 660.32 |
| IUPAC Name | [2,4-ditert-butyl-6-(3,5-ditert-butyl-2-pyridin-3-yloxyphosphanyloxyphenyl)phenoxy]-pyridin-3-yloxyphosphane |
| SMILES | CC(C)(C)c1cc(-c2cc(C(C)(C)C)cc(C(C)(C)C)c2OPOc2cccnc2)c(OPOc2cccnc2)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C38H50N2O4P2/c1-35(2,3)25-19-29(33(31(21-25)37(7,8)9)43-45-41-27-15-13-17-39-23-27)30-20-26(36(4,5)6)22-32(38(10,11)12)34(30)44-46-42-28-16-14-18-40-24-28/h13-24,45-46H,1-12H3 |
| InChIKey | PKDVPSPPWZBORS-UHFFFAOYSA-N |
| XLogP | 11.27 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.78 |
| LogP ≤ 5 | 11.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|