C31H15F2NO7 — CID 21130941
1-[4-[4-(4-cyano-2,3-difluorophenoxy)carbonylphenoxy]carbonylphenyl]hepta-1,2,3,4,5,6-hexaenyl oxirane-2-carboxylate (PubChem CID 21130941) has the molecular formula C31H15F2NO7 and a molecular weight of 551.46 g/mol. Its IUPAC name is 1-[4-[4-(4-cyano-2,3-difluorophenoxy)carbonylphenoxy]carbonylphenyl]hepta-1,2,3,4,5,6-hexaenyl oxirane-2-carboxylate.
| Compound Name | 1-[4-[4-(4-cyano-2,3-difluorophenoxy)carbonylphenoxy]carbonylphenyl]hepta-1,2,3,4,5,6-hexaenyl oxirane-2-carboxylate |
|---|---|
| PubChem CID | 21130941 |
| Molecular Formula | C31H15F2NO7 |
| Molecular Weight | 551.46 g/mol |
| Exact Mass | 551.08 |
| IUPAC Name | 1-[4-[4-(4-cyano-2,3-difluorophenoxy)carbonylphenoxy]carbonylphenyl]hepta-1,2,3,4,5,6-hexaenyl oxirane-2-carboxylate |
| SMILES | C=C=C=C=C=C=C(OC(=O)C1CO1)c1ccc(C(=O)Oc2ccc(C(=O)Oc3ccc(C#N)c(F)c3F)cc2)cc1 |
| InChI | InChI=1S/C31H15F2NO7/c1-2-3-4-5-6-24(40-31(37)26-18-38-26)19-7-9-20(10-8-19)29(35)39-23-14-11-21(12-15-23)30(36)41-25-16-13-22(17-34)27(32)28(25)33/h7-16,26H,1,18H2 |
| InChIKey | QKNAGYQFOYYNAB-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 115.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.46 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|