C28H10F8S4 — CID 21131069
2-(2,3,5,6-tetrafluoro-4-thiophen-2-ylphenyl)-5-[5-(2,3,5,6-tetrafluoro-4-thiophen-2-ylphenyl)thiophen-2-yl]thiophene (PubChem CID 21131069) has the molecular formula C28H10F8S4 and a molecular weight of 626.64 g/mol. Its IUPAC name is 2-(2,3,5,6-tetrafluoro-4-thiophen-2-ylphenyl)-5-[5-(2,3,5,6-tetrafluoro-4-thiophen-2-ylphenyl)thiophen-2-yl]thiophene.
| Compound Name | 2-(2,3,5,6-tetrafluoro-4-thiophen-2-ylphenyl)-5-[5-(2,3,5,6-tetrafluoro-4-thiophen-2-ylphenyl)thiophen-2-yl]thiophene |
|---|---|
| PubChem CID | 21131069 |
| Molecular Formula | C28H10F8S4 |
| Molecular Weight | 626.64 g/mol |
| Exact Mass | 625.95 |
| IUPAC Name | 2-(2,3,5,6-tetrafluoro-4-thiophen-2-ylphenyl)-5-[5-(2,3,5,6-tetrafluoro-4-thiophen-2-ylphenyl)thiophen-2-yl]thiophene |
| SMILES | Fc1c(F)c(-c2ccc(-c3ccc(-c4c(F)c(F)c(-c5cccs5)c(F)c4F)s3)s2)c(F)c(F)c1-c1cccs1 |
| InChI | InChI=1S/C28H10F8S4/c29-21-17(13-3-1-9-37-13)22(30)26(34)19(25(21)33)15-7-5-11(39-15)12-6-8-16(40-12)20-27(35)23(31)18(24(32)28(20)36)14-4-2-10-38-14/h1-10H |
| InChIKey | AQNKDDUDXUIKKA-UHFFFAOYSA-N |
| XLogP | 11.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.64 |
| LogP ≤ 5 | 11.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|