C28H8F10S4 — CID 21131073
2-(2,3,4,5,6-pentafluorophenyl)-5-[5-[5-[5-(2,3,4,5,6-pentafluorophenyl)thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]thiophene (PubChem CID 21131073) has the molecular formula C28H8F10S4 and a molecular weight of 662.62 g/mol. Its IUPAC name is 2-(2,3,4,5,6-pentafluorophenyl)-5-[5-[5-[5-(2,3,4,5,6-pentafluorophenyl)thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]thiophene.
| Compound Name | 2-(2,3,4,5,6-pentafluorophenyl)-5-[5-[5-[5-(2,3,4,5,6-pentafluorophenyl)thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]thiophene |
|---|---|
| PubChem CID | 21131073 |
| Molecular Formula | C28H8F10S4 |
| Molecular Weight | 662.62 g/mol |
| Exact Mass | 661.93 |
| IUPAC Name | 2-(2,3,4,5,6-pentafluorophenyl)-5-[5-[5-[5-(2,3,4,5,6-pentafluorophenyl)thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]thiophene |
| SMILES | Fc1c(F)c(F)c(-c2ccc(-c3ccc(-c4ccc(-c5ccc(-c6c(F)c(F)c(F)c(F)c6F)s5)s4)s3)s2)c(F)c1F |
| InChI | InChI=1S/C28H8F10S4/c29-19-17(20(30)24(34)27(37)23(19)33)15-7-5-13(41-15)11-3-1-9(39-11)10-2-4-12(40-10)14-6-8-16(42-14)18-21(31)25(35)28(38)26(36)22(18)32/h1-8H |
| InChIKey | CPCYRHXNGWLCAC-UHFFFAOYSA-N |
| XLogP | 11.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.62 |
| LogP ≤ 5 | 11.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|