C15H18N2O10 — CID 21131089
2-[[(1,2-dicarboxy-2-hydroxyethyl)-prop-2-ynylamino]methyl-prop-2-ynylamino]-3-hydroxybutanedioic acid (PubChem CID 21131089) has the molecular formula C15H18N2O10 and a molecular weight of 386.31 g/mol. Its IUPAC name is 2-[[(1,2-dicarboxy-2-hydroxyethyl)-prop-2-ynylamino]methyl-prop-2-ynylamino]-3-hydroxybutanedioic acid.
| Compound Name | 2-[[(1,2-dicarboxy-2-hydroxyethyl)-prop-2-ynylamino]methyl-prop-2-ynylamino]-3-hydroxybutanedioic acid |
|---|---|
| PubChem CID | 21131089 |
| Molecular Formula | C15H18N2O10 |
| Molecular Weight | 386.31 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | 2-[[(1,2-dicarboxy-2-hydroxyethyl)-prop-2-ynylamino]methyl-prop-2-ynylamino]-3-hydroxybutanedioic acid |
| SMILES | C#CCN(CN(CC#C)C(C(=O)O)C(O)C(=O)O)C(C(=O)O)C(O)C(=O)O |
| InChI | InChI=1S/C15H18N2O10/c1-3-5-16(8(12(20)21)10(18)14(24)25)7-17(6-4-2)9(13(22)23)11(19)15(26)27/h1-2,8-11,18-19H,5-7H2,(H,20,21)(H,22,23)(H,24,25)(H,26,27) |
| InChIKey | SADASICLSUFTJV-UHFFFAOYSA-N |
| XLogP | -3.39 |
| TPSA | 196.14 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.31 |
| LogP ≤ 5 | -3.39 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|