C24H35N6O6+ — CID 21131229
7-isocyanato-2,4-bis(6-isocyanatohexyl)-2,4-diaza-6-azoniaspiro[5.6]dodecane-1,3,5-trione (PubChem CID 21131229) has the molecular formula C24H35N6O6+ and a molecular weight of 503.58 g/mol. Its IUPAC name is 7-isocyanato-2,4-bis(6-isocyanatohexyl)-2,4-diaza-6-azoniaspiro[5.6]dodecane-1,3,5-trione.
| Compound Name | 7-isocyanato-2,4-bis(6-isocyanatohexyl)-2,4-diaza-6-azoniaspiro[5.6]dodecane-1,3,5-trione |
|---|---|
| PubChem CID | 21131229 |
| Molecular Formula | C24H35N6O6+ |
| Molecular Weight | 503.58 g/mol |
| Exact Mass | 503.26 |
| IUPAC Name | 7-isocyanato-2,4-bis(6-isocyanatohexyl)-2,4-diaza-6-azoniaspiro[5.6]dodecane-1,3,5-trione |
| SMILES | O=C=NCCCCCCN1C(=O)N(CCCCCCN=C=O)C(=O)[N+]2(CCCCCC2N=C=O)C1=O |
| InChI | InChI=1S/C24H35N6O6/c31-18-25-13-7-1-3-9-15-28-22(34)29(16-10-4-2-8-14-26-19-32)24(36)30(23(28)35)17-11-5-6-12-21(30)27-20-33/h21H,1-17H2/q+1 |
| InChIKey | UAPKVCQSPRBMFE-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 145.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.58 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|