C8H20N2 — CID 21131556
N,N,N'-trimethyl-N'-propylethane-1,2-diamine (PubChem CID 21131556) has the molecular formula C8H20N2 and a molecular weight of 144.26 g/mol. Its IUPAC name is N,N,N'-trimethyl-N'-propylethane-1,2-diamine.
| Compound Name | N,N,N'-trimethyl-N'-propylethane-1,2-diamine |
|---|---|
| PubChem CID | 21131556 |
| Molecular Formula | C8H20N2 |
| Molecular Weight | 144.26 g/mol |
| Exact Mass | 144.16 |
| IUPAC Name | N,N,N'-trimethyl-N'-propylethane-1,2-diamine |
| SMILES | CCCN(C)CCN(C)C |
| InChI | InChI=1S/C8H20N2/c1-5-6-10(4)8-7-9(2)3/h5-8H2,1-4H3 |
| InChIKey | OCZSNIABVJCQDB-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.26 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |