C30H46Cl2N2O2Si2 — CID 21131748
4-N,5-N-bis(4-chloro-2,6-dimethylphenyl)-1,8-bis(trimethylsilyloxy)octane-4,5-diimine (PubChem CID 21131748) has the molecular formula C30H46Cl2N2O2Si2 and a molecular weight of 593.79 g/mol. Its IUPAC name is 4-N,5-N-bis(4-chloro-2,6-dimethylphenyl)-1,8-bis(trimethylsilyloxy)octane-4,5-diimine.
| Compound Name | 4-N,5-N-bis(4-chloro-2,6-dimethylphenyl)-1,8-bis(trimethylsilyloxy)octane-4,5-diimine |
|---|---|
| PubChem CID | 21131748 |
| Molecular Formula | C30H46Cl2N2O2Si2 |
| Molecular Weight | 593.79 g/mol |
| Exact Mass | 592.25 |
| IUPAC Name | 4-N,5-N-bis(4-chloro-2,6-dimethylphenyl)-1,8-bis(trimethylsilyloxy)octane-4,5-diimine |
| SMILES | Cc1cc(Cl)cc(C)c1/N=C(CCCO[Si](C)(C)C)/C(CCCO[Si](C)(C)C)=N/c1c(C)cc(Cl)cc1C |
| InChI | InChI=1S/C30H46Cl2N2O2Si2/c1-21-17-25(31)18-22(2)29(21)33-27(13-11-15-35-37(5,6)7)28(14-12-16-36-38(8,9)10)34-30-23(3)19-26(32)20-24(30)4/h17-20H,11-16H2,1-10H3/b33-27+,34-28+ |
| InChIKey | JMFDMZHBECWLAS-SWMYPXFDSA-N |
| XLogP | 10.34 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.79 |
| LogP ≤ 5 | 10.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|